C29H32F3N3O6 — CID 122576528
(E)-N-[(2S,3R,4R,5S,6S)-3,5-dimethoxy-6-methyl-4-propoxyoxan-2-yl]oxy-1-[4-[5-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]phenyl]methanimine (PubChem CID 122576528) has the molecular formula C29H32F3N3O6 and a molecular weight of 575.58 g/mol. Its IUPAC name is (E)-N-[(2S,3R,4R,5S,6S)-3,5-dimethoxy-6-methyl-4-propoxyoxan-2-yl]oxy-1-[4-[5-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]phenyl]methanimine.
| Compound Name | (E)-N-[(2S,3R,4R,5S,6S)-3,5-dimethoxy-6-methyl-4-propoxyoxan-2-yl]oxy-1-[4-[5-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]phenyl]methanimine |
|---|---|
| PubChem CID | 122576528 |
| Molecular Formula | C29H32F3N3O6 |
| Molecular Weight | 575.58 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | (E)-N-[(2S,3R,4R,5S,6S)-3,5-dimethoxy-6-methyl-4-propoxyoxan-2-yl]oxy-1-[4-[5-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]phenyl]methanimine |
| SMILES | CCCO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](O/N=C/c2ccc(-c3ncc(-c4ccc(OC(F)(F)F)cc4)cn3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C29H32F3N3O6/c1-5-14-38-25-24(36-3)18(2)39-28(26(25)37-4)41-35-15-19-6-8-21(9-7-19)27-33-16-22(17-34-27)20-10-12-23(13-11-20)40-29(30,31)32/h6-13,15-18,24-26,28H,5,14H2,1-4H3/b35-15+/t18-,24-,25+,26+,28-/m0/s1 |
| InChIKey | LHEDJYVLFWISIW-AFUNZICUSA-N |
| XLogP | 5.63 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|