C29H33F5N4O6 — CID 122576621
(E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3-methoxy-6-methyl-5-propoxyoxan-2-yl]oxy-1-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methanimine (PubChem CID 122576621) has the molecular formula C29H33F5N4O6 and a molecular weight of 628.60 g/mol. Its IUPAC name is (E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3-methoxy-6-methyl-5-propoxyoxan-2-yl]oxy-1-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methanimine.
| Compound Name | (E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3-methoxy-6-methyl-5-propoxyoxan-2-yl]oxy-1-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methanimine |
|---|---|
| PubChem CID | 122576621 |
| Molecular Formula | C29H33F5N4O6 |
| Molecular Weight | 628.60 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | (E)-N-[(2S,3R,4R,5S,6S)-4-ethoxy-3-methoxy-6-methyl-5-propoxyoxan-2-yl]oxy-1-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methanimine |
| SMILES | CCCO[C@@H]1[C@@H](OCC)[C@@H](OC)[C@H](O/N=C/c2ccc(-c3ncn(-c4ccc(OC(F)(F)C(F)(F)F)cc4)n3)cc2)O[C@H]1C |
| InChI | InChI=1S/C29H33F5N4O6/c1-5-15-41-23-18(3)42-27(25(39-4)24(23)40-6-2)44-36-16-19-7-9-20(10-8-19)26-35-17-38(37-26)21-11-13-22(14-12-21)43-29(33,34)28(30,31)32/h7-14,16-18,23-25,27H,5-6,15H2,1-4H3/b36-16+/t18-,23-,24+,25+,27-/m0/s1 |
| InChIKey | ZJVWUJMZSLCGIB-GSIAFOGSSA-N |
| XLogP | 5.78 |
| TPSA | 98.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|