C29H32F5N2O5P — CID 90261782
[(2S,3S,5S,6R)-3,5-dimethoxy-2-methyl-6-[[5-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]pyrazol-3-yl]-2,3-dihydro-1H-inden-2-yl]oxy]oxan-4-yl]-methylphosphane (PubChem CID 90261782) has the molecular formula C29H32F5N2O5P and a molecular weight of 614.55 g/mol. Its IUPAC name is [(2S,3S,5S,6R)-3,5-dimethoxy-2-methyl-6-[[5-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]pyrazol-3-yl]-2,3-dihydro-1H-inden-2-yl]oxy]oxan-4-yl]-methylphosphane.
| Compound Name | [(2S,3S,5S,6R)-3,5-dimethoxy-2-methyl-6-[[5-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]pyrazol-3-yl]-2,3-dihydro-1H-inden-2-yl]oxy]oxan-4-yl]-methylphosphane |
|---|---|
| PubChem CID | 90261782 |
| Molecular Formula | C29H32F5N2O5P |
| Molecular Weight | 614.55 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | [(2S,3S,5S,6R)-3,5-dimethoxy-2-methyl-6-[[5-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]pyrazol-3-yl]-2,3-dihydro-1H-inden-2-yl]oxy]oxan-4-yl]-methylphosphane |
| SMILES | CO[C@@H]1C(PC)[C@@H](OC)[C@H](C)O[C@H]1OC1Cc2ccc(-c3ccn(-c4ccc(OC(F)(F)C(F)(F)F)cc4)n3)cc2C1 |
| InChI | InChI=1S/C29H32F5N2O5P/c1-16-24(37-2)26(42-4)25(38-3)27(39-16)40-22-14-17-5-6-18(13-19(17)15-22)23-11-12-36(35-23)20-7-9-21(10-8-20)41-29(33,34)28(30,31)32/h5-13,16,22,24-27,42H,14-15H2,1-4H3/t16-,22?,24-,25+,26?,27-/m0/s1 |
| InChIKey | IPDCKZUECSNEGO-WYHDROCNSA-N |
| XLogP | 6.01 |
| TPSA | 63.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|