C20H38O9 — CID 142763970
(2R,3R,4R,5S,6S)-4-ethoxy-2-[(2R,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-3,5-dimethoxy-6-methyloxane (PubChem CID 142763970) has the molecular formula C20H38O9 and a molecular weight of 422.52 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-4-ethoxy-2-[(2R,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-3,5-dimethoxy-6-methyloxane.
| Compound Name | (2R,3R,4R,5S,6S)-4-ethoxy-2-[(2R,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-3,5-dimethoxy-6-methyloxane |
|---|---|
| PubChem CID | 142763970 |
| Molecular Formula | C20H38O9 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | (2R,3R,4R,5S,6S)-4-ethoxy-2-[(2R,3R,4R,5S,6S)-4-ethoxy-3,5-dimethoxy-6-methyloxan-2-yl]oxy-3,5-dimethoxy-6-methyloxane |
| SMILES | CCO[C@@H]1[C@@H](OC)[C@H](C)O[C@H](O[C@H]2O[C@@H](C)[C@H](OC)[C@@H](OCC)[C@H]2OC)[C@@H]1OC |
| InChI | InChI=1S/C20H38O9/c1-9-25-15-13(21-5)11(3)27-19(17(15)23-7)29-20-18(24-8)16(26-10-2)14(22-6)12(4)28-20/h11-20H,9-10H2,1-8H3/t11-,12-,13-,14-,15+,16+,17+,18+,19+,20+/m0/s1 |
| InChIKey | REFISEHKXYWFHL-WGRVOKSLSA-N |
| XLogP | 1.36 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |