C6H10O7 — CID 175693945
(3S,4S,5R,6R)-3,4,5,6,7-pentahydroxyoxepan-2-one (PubChem CID 175693945) has the molecular formula C6H10O7 and a molecular weight of 194.14 g/mol. Its IUPAC name is (3S,4S,5R,6R)-3,4,5,6,7-pentahydroxyoxepan-2-one.
| Compound Name | (3S,4S,5R,6R)-3,4,5,6,7-pentahydroxyoxepan-2-one |
|---|---|
| PubChem CID | 175693945 |
| Molecular Formula | C6H10O7 |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | (3S,4S,5R,6R)-3,4,5,6,7-pentahydroxyoxepan-2-one |
| SMILES | O=C1OC(O)[C@H](O)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(10)6(12)13-5(11)3(1)9/h1-5,7-11H/t1-,2+,3-,4+,5?/m1/s1 |
| InChIKey | DJMZGFKDMNNTFE-WODNZJQCSA-N |
| XLogP | -3.69 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |