C8H12BNO7 — CID 167491210
CID 167491210 (PubChem CID 167491210) has the molecular formula C8H12BNO7 and a molecular weight of 245.00 g/mol.
| Compound Name | CID 167491210 |
|---|---|
| PubChem CID | 167491210 |
| Molecular Formula | C8H12BNO7 |
| Molecular Weight | 245.00 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | — |
| SMILES | [B]N(O)C(=O)C/C=C1/O[C@H](O)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C8H12BNO7/c9-10(16)4(11)2-1-3-5(12)6(13)7(14)8(15)17-3/h1,5-8,12-16H,2H2/b3-1+/t5-,6?,7?,8+/m1/s1 |
| InChIKey | RPFMEBHJVJLQFH-YXYRZAJQSA-N |
| XLogP | -3.01 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.00 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|