C8H13NO6 — CID 89406295
(2R,3aS,6S,6aR)-3,6-dihydroxy-2-[methoxy(methyl)amino]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 89406295) has the molecular formula C8H13NO6 and a molecular weight of 219.19 g/mol. Its IUPAC name is (2R,3aS,6S,6aR)-3,6-dihydroxy-2-[methoxy(methyl)amino]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (2R,3aS,6S,6aR)-3,6-dihydroxy-2-[methoxy(methyl)amino]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 89406295 |
| Molecular Formula | C8H13NO6 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | (2R,3aS,6S,6aR)-3,6-dihydroxy-2-[methoxy(methyl)amino]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | CON(C)[C@@H]1O[C@@H]2[C@H](O)C(=O)O[C@H]2C1O |
| InChI | InChI=1S/C8H13NO6/c1-9(13-2)7-3(10)5-6(14-7)4(11)8(12)15-5/h3-7,10-11H,1-2H3/t3?,4-,5-,6+,7+/m0/s1 |
| InChIKey | FBUAVPISMBBUTL-NGMGSTNOSA-N |
| XLogP | -2.15 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|