C8H7Cl3O6 — CID 24838354
(1S,2R,8R,9S)-9-hydroxy-4-(trichloromethyl)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one (PubChem CID 24838354) has the molecular formula C8H7Cl3O6 and a molecular weight of 305.50 g/mol. Its IUPAC name is (1S,2R,8R,9S)-9-hydroxy-4-(trichloromethyl)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one.
| Compound Name | (1S,2R,8R,9S)-9-hydroxy-4-(trichloromethyl)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
|---|---|
| PubChem CID | 24838354 |
| Molecular Formula | C8H7Cl3O6 |
| Molecular Weight | 305.50 g/mol |
| Exact Mass | 303.93 |
| IUPAC Name | (1S,2R,8R,9S)-9-hydroxy-4-(trichloromethyl)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
| SMILES | O=C1O[C@H]2[C@H](OC3OC(C(Cl)(Cl)Cl)O[C@@H]32)[C@@H]1O |
| InChI | InChI=1S/C8H7Cl3O6/c9-8(10,11)7-16-4-3-2(15-6(4)17-7)1(12)5(13)14-3/h1-4,6-7,12H/t1-,2+,3-,4+,6?,7?/m0/s1 |
| InChIKey | SZZBSNPAGIIYKI-BMJXBHDESA-N |
| XLogP | 0.11 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.50 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|