C10H10Cl6O6 — CID 125036827
(2S,3aR,5R,6R,6aS)-2-(trichloromethyl)-5-[(2S,4S)-2-(trichloromethyl)-1,3-dioxolan-4-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 125036827) has the molecular formula C10H10Cl6O6 and a molecular weight of 438.90 g/mol. Its IUPAC name is (2S,3aR,5R,6R,6aS)-2-(trichloromethyl)-5-[(2S,4S)-2-(trichloromethyl)-1,3-dioxolan-4-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (2S,3aR,5R,6R,6aS)-2-(trichloromethyl)-5-[(2S,4S)-2-(trichloromethyl)-1,3-dioxolan-4-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 125036827 |
| Molecular Formula | C10H10Cl6O6 |
| Molecular Weight | 438.90 g/mol |
| Exact Mass | 435.86 |
| IUPAC Name | (2S,3aR,5R,6R,6aS)-2-(trichloromethyl)-5-[(2S,4S)-2-(trichloromethyl)-1,3-dioxolan-4-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | O[C@H]1[C@@H]2O[C@H](C(Cl)(Cl)Cl)O[C@H]2O[C@H]1[C@@H]1CO[C@H](C(Cl)(Cl)Cl)O1 |
| InChI | InChI=1S/C10H10Cl6O6/c11-9(12,13)7-18-1-2(19-7)4-3(17)5-6(20-4)22-8(21-5)10(14,15)16/h2-8,17H,1H2/t2-,3+,4-,5-,6+,7-,8-/m0/s1 |
| InChIKey | YYRLUIQHYPPKGI-IWGMIPLFSA-N |
| XLogP | 2.30 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.90 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|