C7H10Cl3NO4 — CID 46918488
(3aR,5S,6S,6aR)-5-(aminomethyl)-2-(trichloromethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 46918488) has the molecular formula C7H10Cl3NO4 and a molecular weight of 278.52 g/mol. Its IUPAC name is (3aR,5S,6S,6aR)-5-(aminomethyl)-2-(trichloromethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5S,6S,6aR)-5-(aminomethyl)-2-(trichloromethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 46918488 |
| Molecular Formula | C7H10Cl3NO4 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | (3aR,5S,6S,6aR)-5-(aminomethyl)-2-(trichloromethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | NC[C@@H]1O[C@@H]2OC(C(Cl)(Cl)Cl)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C7H10Cl3NO4/c8-7(9,10)6-14-4-3(12)2(1-11)13-5(4)15-6/h2-6,12H,1,11H2/t2-,3-,4+,5+,6?/m0/s1 |
| InChIKey | WBCDXIOPLPDKMD-JFNONXLTSA-N |
| XLogP | 0.14 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|