C6H13ClN2O3 — CID 22816603
(2R,3S,4R,5R)-5-amino-2-(aminomethyl)-6-chlorooxane-3,4-diol (PubChem CID 22816603) has the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-amino-2-(aminomethyl)-6-chlorooxane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-5-amino-2-(aminomethyl)-6-chlorooxane-3,4-diol |
|---|---|
| PubChem CID | 22816603 |
| Molecular Formula | C6H13ClN2O3 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | (2R,3S,4R,5R)-5-amino-2-(aminomethyl)-6-chlorooxane-3,4-diol |
| SMILES | NC[C@H]1OC(Cl)[C@H](N)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13ClN2O3/c7-6-3(9)5(11)4(10)2(1-8)12-6/h2-6,10-11H,1,8-9H2/t2-,3-,4-,5-,6?/m1/s1 |
| InChIKey | IDEBXVPFPSKBTG-IVMDWMLBSA-N |
| XLogP | -2.04 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|