C12H26N4O5 — CID 11702250
(2R,3S,4R,5R,6S)-5-amino-2-(aminomethyl)-6-[(1S,2S,4S,5S)-2,4-diamino-5-hydroxycyclohexyl]oxyoxane-3,4-diol (PubChem CID 11702250) has the molecular formula C12H26N4O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-5-amino-2-(aminomethyl)-6-[(1S,2S,4S,5S)-2,4-diamino-5-hydroxycyclohexyl]oxyoxane-3,4-diol.
| Compound Name | (2R,3S,4R,5R,6S)-5-amino-2-(aminomethyl)-6-[(1S,2S,4S,5S)-2,4-diamino-5-hydroxycyclohexyl]oxyoxane-3,4-diol |
|---|---|
| PubChem CID | 11702250 |
| Molecular Formula | C12H26N4O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (2R,3S,4R,5R,6S)-5-amino-2-(aminomethyl)-6-[(1S,2S,4S,5S)-2,4-diamino-5-hydroxycyclohexyl]oxyoxane-3,4-diol |
| SMILES | NC[C@H]1O[C@H](O[C@H]2C[C@H](O)[C@@H](N)C[C@@H]2N)[C@H](N)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H26N4O5/c13-3-8-10(18)11(19)9(16)12(21-8)20-7-2-6(17)4(14)1-5(7)15/h4-12,17-19H,1-3,13-16H2/t4-,5-,6-,7-,8+,9+,10+,11+,12-/m0/s1 |
| InChIKey | WYDAKHOZEGJEGE-FAKAELCTSA-N |
| XLogP | -4.09 |
| TPSA | 183.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |