C18H36N4O10 — CID 11216246
(2R,3S,4S,5R,6S)-2-(aminomethyl)-6-[(1R,2R,4R,5R)-2,4-diamino-5-[(2S,3R,4S,5S,6R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]oxycyclohexyl]oxyoxane-3,4,5-triol (PubChem CID 11216246) has the molecular formula C18H36N4O10 and a molecular weight of 468.50 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(aminomethyl)-6-[(1R,2R,4R,5R)-2,4-diamino-5-[(2S,3R,4S,5S,6R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]oxycyclohexyl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(aminomethyl)-6-[(1R,2R,4R,5R)-2,4-diamino-5-[(2S,3R,4S,5S,6R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]oxycyclohexyl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 11216246 |
| Molecular Formula | C18H36N4O10 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(aminomethyl)-6-[(1R,2R,4R,5R)-2,4-diamino-5-[(2S,3R,4S,5S,6R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]oxycyclohexyl]oxyoxane-3,4,5-triol |
| SMILES | NC[C@H]1O[C@H](O[C@@H]2C[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@H](N)C[C@H]2N)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H36N4O10/c19-3-9-11(23)13(25)15(27)17(31-9)29-7-2-8(6(22)1-5(7)21)30-18-16(28)14(26)12(24)10(4-20)32-18/h5-18,23-28H,1-4,19-22H2/t5-,6-,7-,8-,9-,10-,11-,12-,13+,14+,15-,16-,17+,18+/m1/s1 |
| InChIKey | AWSPYSQIGVBBAS-WKXRHVNMSA-N |
| XLogP | -6.26 |
| TPSA | 262.38 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | -6.26 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |