C12H25N3O6 — CID 11544042
(2S,3R,4R,5S,6R)-2-(aminomethyl)-6-[(1R,2R,4R,5R)-2,4-diamino-5-hydroxycyclohexyl]oxyoxane-3,4,5-triol (PubChem CID 11544042) has the molecular formula C12H25N3O6 and a molecular weight of 307.35 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-(aminomethyl)-6-[(1R,2R,4R,5R)-2,4-diamino-5-hydroxycyclohexyl]oxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-(aminomethyl)-6-[(1R,2R,4R,5R)-2,4-diamino-5-hydroxycyclohexyl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 11544042 |
| Molecular Formula | C12H25N3O6 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-(aminomethyl)-6-[(1R,2R,4R,5R)-2,4-diamino-5-hydroxycyclohexyl]oxyoxane-3,4,5-triol |
| SMILES | NC[C@@H]1O[C@@H](O[C@@H]2C[C@@H](O)[C@H](N)C[C@H]2N)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H25N3O6/c13-3-8-9(17)10(18)11(19)12(21-8)20-7-2-6(16)4(14)1-5(7)15/h4-12,16-19H,1-3,13-15H2/t4-,5-,6-,7-,8+,9+,10-,11+,12-/m1/s1 |
| InChIKey | OXRMKOZMTPVFGJ-IGELRRLDSA-N |
| XLogP | -4.05 |
| TPSA | 177.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -4.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |