About CID 59102120
CID 59102120 (PubChem CID 59102120) has the molecular formula C5H10NO3Se
and a molecular weight of 211.10 g/mol.
Molecular Properties
| Compound Name | CID 59102120 |
| PubChem CID | 59102120 |
| Molecular Formula | C5H10NO3Se |
| Molecular Weight | 211.10 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | — |
| SMILES | NCC1OC([Se])C(O)C1O |
| InChI | InChI=1S/C5H10NO3Se/c6-1-2-3(7)4(8)5(10)9-2/h2-5,7-8H,1,6H2 |
| InChIKey | DYGKRYYVWLFTKG-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.10 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59102120 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59102120?
The IUPAC name of CID 59102120 (CID 59102120) is not available.
What is the SMILES notation for CID 59102120?
The canonical SMILES for CID 59102120 is NCC1OC([Se])C(O)C1O.
What is the InChIKey of CID 59102120?
The InChIKey is DYGKRYYVWLFTKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NO3Se/c6-1-2-3(7)4(8)5(10)9-2/h2-5,7-8H,1,6H2.
What are the key properties of CID 59102120?
CID 59102120 has a molecular weight of 211.10 g/mol, XLogP of -2.44, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59102120 is sourced from PubChem (CID 59102120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).