C8H18N2O4 — CID 143647712
2-(1-aminoethyl)-6-(aminomethyl)oxane-3,4,5-triol (PubChem CID 143647712) has the molecular formula C8H18N2O4 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(1-aminoethyl)-6-(aminomethyl)oxane-3,4,5-triol.
| Compound Name | 2-(1-aminoethyl)-6-(aminomethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 143647712 |
| Molecular Formula | C8H18N2O4 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-(1-aminoethyl)-6-(aminomethyl)oxane-3,4,5-triol |
| SMILES | CC(N)C1OC(CN)C(O)C(O)C1O |
| InChI | InChI=1S/C8H18N2O4/c1-3(10)8-7(13)6(12)5(11)4(2-9)14-8/h3-8,11-13H,2,9-10H2,1H3 |
| InChIKey | YCYYOARLXUKNIP-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |