C10H20O4 — CID 71288921
2-ethyl-6-propan-2-yloxane-3,4,5-triol (PubChem CID 71288921) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-ethyl-6-propan-2-yloxane-3,4,5-triol.
| Compound Name | 2-ethyl-6-propan-2-yloxane-3,4,5-triol |
|---|---|
| PubChem CID | 71288921 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-ethyl-6-propan-2-yloxane-3,4,5-triol |
| SMILES | CCC1OC(C(C)C)C(O)C(O)C1O |
| InChI | InChI=1S/C10H20O4/c1-4-6-7(11)8(12)9(13)10(14-6)5(2)3/h5-13H,4H2,1-3H3 |
| InChIKey | IFWXAEICBKVOOF-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |