C11H22O5 — CID 134379068
5-ethoxy-6-(hydroxymethyl)-2-propan-2-yloxane-3,4-diol (PubChem CID 134379068) has the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. Its IUPAC name is 5-ethoxy-6-(hydroxymethyl)-2-propan-2-yloxane-3,4-diol.
| Compound Name | 5-ethoxy-6-(hydroxymethyl)-2-propan-2-yloxane-3,4-diol |
|---|---|
| PubChem CID | 134379068 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 5-ethoxy-6-(hydroxymethyl)-2-propan-2-yloxane-3,4-diol |
| SMILES | CCOC1C(CO)OC(C(C)C)C(O)C1O |
| InChI | InChI=1S/C11H22O5/c1-4-15-11-7(5-12)16-10(6(2)3)8(13)9(11)14/h6-14H,4-5H2,1-3H3 |
| InChIKey | JIGGQRDOHFVICB-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |