C9H18O6 — CID 174113767
(2R,5S)-5-ethoxy-2,6-bis(hydroxymethyl)oxane-3,4-diol (PubChem CID 174113767) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is (2R,5S)-5-ethoxy-2,6-bis(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,5S)-5-ethoxy-2,6-bis(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 174113767 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (2R,5S)-5-ethoxy-2,6-bis(hydroxymethyl)oxane-3,4-diol |
| SMILES | CCO[C@@H]1C(CO)O[C@H](CO)C(O)C1O |
| InChI | InChI=1S/C9H18O6/c1-2-14-9-6(4-11)15-5(3-10)7(12)8(9)13/h5-13H,2-4H2,1H3/t5-,6?,7?,8?,9-/m1/s1 |
| InChIKey | LBTZLIQWDJOZGG-NHMDFMCYSA-N |
| XLogP | -2.13 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |