C10H20O5 — CID 77486705
2-butan-2-yl-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 77486705) has the molecular formula C10H20O5 and a molecular weight of 220.26 g/mol. Its IUPAC name is 2-butan-2-yl-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-butan-2-yl-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 77486705 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-butan-2-yl-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCC(C)C1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C10H20O5/c1-3-5(2)10-9(14)8(13)7(12)6(4-11)15-10/h5-14H,3-4H2,1-2H3 |
| InChIKey | COUWSYJCLWEJIV-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |