C13H24O7 — CID 174516009
3-methyl-5-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoic acid (PubChem CID 174516009) has the molecular formula C13H24O7 and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-methyl-5-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoic acid.
| Compound Name | 3-methyl-5-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 174516009 |
| Molecular Formula | C13H24O7 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-methyl-5-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoic acid |
| SMILES | CC(CC(=O)O)CC(C)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H24O7/c1-6(4-9(15)16)3-7(2)13-12(19)11(18)10(17)8(5-14)20-13/h6-8,10-14,17-19H,3-5H2,1-2H3,(H,15,16)/t6?,7?,8-,10-,11+,12-,13-/m1/s1 |
| InChIKey | WHBWOZGVKHOYRW-QEZIXSMGSA-N |
| XLogP | -1.03 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |