C16H32O4 — CID 89443137
(2R,3S,4S,5S)-2-(hydroxymethyl)-5-undecan-2-yloxolane-3,4-diol (PubChem CID 89443137) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-(hydroxymethyl)-5-undecan-2-yloxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5S)-2-(hydroxymethyl)-5-undecan-2-yloxolane-3,4-diol |
|---|---|
| PubChem CID | 89443137 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | (2R,3S,4S,5S)-2-(hydroxymethyl)-5-undecan-2-yloxolane-3,4-diol |
| SMILES | CCCCCCCCCC(C)[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H32O4/c1-3-4-5-6-7-8-9-10-12(2)16-15(19)14(18)13(11-17)20-16/h12-19H,3-11H2,1-2H3/t12?,13-,14-,15+,16+/m1/s1 |
| InChIKey | XKEJQWBTFAYKRC-USNXZVQNSA-N |
| XLogP | 2.24 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|