C6H8O5 — CID 130145131
2,4,6-trioxatricyclo[3.3.1.03,7]nonane-8,9-diol (PubChem CID 130145131) has the molecular formula C6H8O5 and a molecular weight of 160.12 g/mol. Its IUPAC name is 2,4,6-trioxatricyclo[3.3.1.03,7]nonane-8,9-diol.
| Compound Name | 2,4,6-trioxatricyclo[3.3.1.03,7]nonane-8,9-diol |
|---|---|
| PubChem CID | 130145131 |
| Molecular Formula | C6H8O5 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 2,4,6-trioxatricyclo[3.3.1.03,7]nonane-8,9-diol |
| SMILES | OC1C2OC3OC1C(O)C3O2 |
| InChI | InChI=1S/C6H8O5/c7-1-3-2(8)5-10-4(1)6(9-3)11-5/h1-8H |
| InChIKey | MQLVUUKMWOHFPQ-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |