C6H6O4 — CID 45120387
3,6,8,10-tetraoxatetracyclo[7.1.0.02,4.05,7]decane (PubChem CID 45120387) has the molecular formula C6H6O4 and a molecular weight of 142.11 g/mol. Its IUPAC name is 3,6,8,10-tetraoxatetracyclo[7.1.0.02,4.05,7]decane.
| Compound Name | 3,6,8,10-tetraoxatetracyclo[7.1.0.02,4.05,7]decane |
|---|---|
| PubChem CID | 45120387 |
| Molecular Formula | C6H6O4 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 3,6,8,10-tetraoxatetracyclo[7.1.0.02,4.05,7]decane |
| SMILES | O1C2OC2C2OC2C2OC12 |
| InChI | InChI=1S/C6H6O4/c7-1-2(7)4-6(9-4)10-5-3(1)8-5/h1-6H |
| InChIKey | CUFFZHATOIAGQV-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 46.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|