C10H15ClO7 — CID 166083195
9-(chloromethyl)-4,11-dimethoxy-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane (PubChem CID 166083195) has the molecular formula C10H15ClO7 and a molecular weight of 282.68 g/mol. Its IUPAC name is 9-(chloromethyl)-4,11-dimethoxy-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane.
| Compound Name | 9-(chloromethyl)-4,11-dimethoxy-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 166083195 |
| Molecular Formula | C10H15ClO7 |
| Molecular Weight | 282.68 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 9-(chloromethyl)-4,11-dimethoxy-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
| SMILES | COC1OC2OC3C(CCl)OC(OC)OC3C2O1 |
| InChI | InChI=1S/C10H15ClO7/c1-12-9-14-4(3-11)5-6(16-9)7-8(15-5)18-10(13-2)17-7/h4-10H,3H2,1-2H3 |
| InChIKey | OISKXGLZQMVIHW-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.68 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|