C14H20O10 — CID 71171228
[(2R)-6,7-diacetyloxy-2-methoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate (PubChem CID 71171228) has the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. Its IUPAC name is [(2R)-6,7-diacetyloxy-2-methoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate.
| Compound Name | [(2R)-6,7-diacetyloxy-2-methoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate |
|---|---|
| PubChem CID | 71171228 |
| Molecular Formula | C14H20O10 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | [(2R)-6,7-diacetyloxy-2-methoxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate |
| SMILES | CO[C@H]1OC2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2O1 |
| InChI | InChI=1S/C14H20O10/c1-6(15)19-5-9-10(20-7(2)16)11(21-8(3)17)12-13(22-9)24-14(18-4)23-12/h9-14H,5H2,1-4H3/t9?,10?,11?,12?,13?,14-/m1/s1 |
| InChIKey | NEZRPWIEWUGKGJ-QCYUVGAGSA-N |
| XLogP | -0.52 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|