C24H29ClO15 — CID 166083190
dimethyl 9-[1-[9-(chloromethyl)-4-ethenyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-11-yl]ethenoxymethyl]-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dicarboxylate (PubChem CID 166083190) has the molecular formula C24H29ClO15 and a molecular weight of 592.93 g/mol. Its IUPAC name is dimethyl 9-[1-[9-(chloromethyl)-4-ethenyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-11-yl]ethenoxymethyl]-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dicarboxylate.
| Compound Name | dimethyl 9-[1-[9-(chloromethyl)-4-ethenyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-11-yl]ethenoxymethyl]-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dicarboxylate |
|---|---|
| PubChem CID | 166083190 |
| Molecular Formula | C24H29ClO15 |
| Molecular Weight | 592.93 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | dimethyl 9-[1-[9-(chloromethyl)-4-ethenyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-11-yl]ethenoxymethyl]-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dicarboxylate |
| SMILES | C=CC1OC2OC3C(CCl)OC(C(=C)OCC4OC(C(=O)OC)OC5C4OC4OC(C(=O)OC)OC45)OC3C2O1 |
| InChI | InChI=1S/C24H29ClO15/c1-5-11-33-16-14-12(35-21(16)34-11)9(6-25)31-20(37-14)8(2)30-7-10-13-15(38-23(32-10)18(26)28-3)17-22(36-13)40-24(39-17)19(27)29-4/h5,9-17,20-24H,1-2,6-7H2,3-4H3 |
| InChIKey | NNADQBDDWXXMGN-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 154.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.93 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|