C25H30O7 — CID 166025829
[2,6-dibenzyl-8-(methoxymethyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]methyl acetate (PubChem CID 166025829) has the molecular formula C25H30O7 and a molecular weight of 442.51 g/mol. Its IUPAC name is [2,6-dibenzyl-8-(methoxymethyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]methyl acetate.
| Compound Name | [2,6-dibenzyl-8-(methoxymethyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]methyl acetate |
|---|---|
| PubChem CID | 166025829 |
| Molecular Formula | C25H30O7 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | [2,6-dibenzyl-8-(methoxymethyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]methyl acetate |
| SMILES | COCC1OC(Cc2ccccc2)OC2C(COC(C)=O)OC(Cc3ccccc3)OC12 |
| InChI | InChI=1S/C25H30O7/c1-17(26)28-16-21-25-24(31-23(30-21)14-19-11-7-4-8-12-19)20(15-27-2)29-22(32-25)13-18-9-5-3-6-10-18/h3-12,20-25H,13-16H2,1-2H3 |
| InChIKey | AVHCURBQPXGFRZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |