C11H18O10S — CID 166083315
(4,11-dimethoxy-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl)methyl methanesulfonate (PubChem CID 166083315) has the molecular formula C11H18O10S and a molecular weight of 342.32 g/mol. Its IUPAC name is (4,11-dimethoxy-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl)methyl methanesulfonate.
| Compound Name | (4,11-dimethoxy-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl)methyl methanesulfonate |
|---|---|
| PubChem CID | 166083315 |
| Molecular Formula | C11H18O10S |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | (4,11-dimethoxy-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl)methyl methanesulfonate |
| SMILES | COC1OC2OC3C(COS(C)(=O)=O)OC(OC)OC3C2O1 |
| InChI | InChI=1S/C11H18O10S/c1-14-10-17-5(4-16-22(3,12)13)6-7(19-10)8-9(18-6)21-11(15-2)20-8/h5-11H,4H2,1-3H3 |
| InChIKey | QXMFDVUFUQYDHR-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|