C8H14O8S2 — CID 135583340
[(2S,3S)-3-[(2S,3S)-3-(methylsulfonyloxymethyl)oxiran-2-yl]oxiran-2-yl]methyl methanesulfonate (PubChem CID 135583340) has the molecular formula C8H14O8S2 and a molecular weight of 302.33 g/mol. Its IUPAC name is [(2S,3S)-3-[(2S,3S)-3-(methylsulfonyloxymethyl)oxiran-2-yl]oxiran-2-yl]methyl methanesulfonate.
| Compound Name | [(2S,3S)-3-[(2S,3S)-3-(methylsulfonyloxymethyl)oxiran-2-yl]oxiran-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 135583340 |
| Molecular Formula | C8H14O8S2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | [(2S,3S)-3-[(2S,3S)-3-(methylsulfonyloxymethyl)oxiran-2-yl]oxiran-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1O[C@@H]1[C@H]1O[C@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C8H14O8S2/c1-17(9,10)13-3-5-7(15-5)8-6(16-8)4-14-18(2,11)12/h5-8H,3-4H2,1-2H3/t5-,6-,7-,8-/m0/s1 |
| InChIKey | MFJOKRDJJGVHTE-XAMCCFCMSA-N |
| XLogP | -1.53 |
| TPSA | 111.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|