About [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate
[(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate (PubChem CID 10380299) has the molecular formula C8H16O8S2
and a molecular weight of 304.34 g/mol. Its IUPAC name is [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate |
| PubChem CID | 10380299 |
| Molecular Formula | C8H16O8S2 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate |
| SMILES | CC1O[C@H](COS(C)(=O)=O)[C@@H](COS(C)(=O)=O)O1 |
| InChI | InChI=1S/C8H16O8S2/c1-6-15-7(4-13-17(2,9)10)8(16-6)5-14-18(3,11)12/h6-8H,4-5H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | VLRQMSUKZCBOLC-HTQZYQBOSA-N |
| XLogP | -0.93 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate?
The IUPAC name of [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate (CID 10380299) is [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate.
What is the SMILES notation for [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate?
The canonical SMILES for [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate is CC1O[C@H](COS(C)(=O)=O)[C@@H](COS(C)(=O)=O)O1.
What is the InChIKey of [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate?
The InChIKey is VLRQMSUKZCBOLC-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H16O8S2/c1-6-15-7(4-13-17(2,9)10)8(16-6)5-14-18(3,11)12/h6-8H,4-5H2,1-3H3/t7-,8-/m1/s1.
What are the key properties of [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate?
[(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate has a molecular weight of 304.34 g/mol, XLogP of -0.93, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate is sourced from PubChem (CID 10380299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).