C8H16O8S2 — CID 10380299
[(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate (PubChem CID 10380299) has the molecular formula C8H16O8S2 and a molecular weight of 304.34 g/mol. Its IUPAC name is [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate.
| Compound Name | [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 10380299 |
| Molecular Formula | C8H16O8S2 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | [(4R,5R)-2-methyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate |
| SMILES | CC1O[C@H](COS(C)(=O)=O)[C@@H](COS(C)(=O)=O)O1 |
| InChI | InChI=1S/C8H16O8S2/c1-6-15-7(4-13-17(2,9)10)8(16-6)5-14-18(3,11)12/h6-8H,4-5H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | VLRQMSUKZCBOLC-HTQZYQBOSA-N |
| XLogP | -0.93 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|