C10H16O6 — CID 90051132
(4,11-dimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methanol (PubChem CID 90051132) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is (4,11-dimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methanol.
| Compound Name | (4,11-dimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methanol |
|---|---|
| PubChem CID | 90051132 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (4,11-dimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methanol |
| SMILES | CC1OC2OC(CO)C3OC(C)OC3C2O1 |
| InChI | InChI=1S/C10H16O6/c1-4-12-7-6(3-11)16-10-9(8(7)13-4)14-5(2)15-10/h4-11H,3H2,1-2H3 |
| InChIKey | VBBDPVTVFLOXRV-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |