C7H8O4 — CID 12528736
(1R,2R,4S,5S,7S,9R)-3,6,10-trioxatetracyclo[7.1.0.02,4.05,7]decan-8-ol (PubChem CID 12528736) has the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. Its IUPAC name is (1R,2R,4S,5S,7S,9R)-3,6,10-trioxatetracyclo[7.1.0.02,4.05,7]decan-8-ol.
| Compound Name | (1R,2R,4S,5S,7S,9R)-3,6,10-trioxatetracyclo[7.1.0.02,4.05,7]decan-8-ol |
|---|---|
| PubChem CID | 12528736 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | (1R,2R,4S,5S,7S,9R)-3,6,10-trioxatetracyclo[7.1.0.02,4.05,7]decan-8-ol |
| SMILES | OC1[C@H]2O[C@H]2[C@@H]2O[C@@H]2[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C7H8O4/c8-1-2-4(9-2)6-7(11-6)5-3(1)10-5/h1-8H/t1?,2-,3+,4-,5+,6+,7- |
| InChIKey | PXUPTDGHUYCTLV-AJPIBUDJSA-N |
| XLogP | -1.34 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|