C6H10N2O3 — CID 130150362
3-oxa-7,8-diazatricyclo[4.2.1.02,4]nonane-5,9-diol (PubChem CID 130150362) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is 3-oxa-7,8-diazatricyclo[4.2.1.02,4]nonane-5,9-diol.
| Compound Name | 3-oxa-7,8-diazatricyclo[4.2.1.02,4]nonane-5,9-diol |
|---|---|
| PubChem CID | 130150362 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 3-oxa-7,8-diazatricyclo[4.2.1.02,4]nonane-5,9-diol |
| SMILES | OC1C2NNC1C1OC1C2O |
| InChI | InChI=1S/C6H10N2O3/c9-3-1-4(10)6-5(11-6)2(3)8-7-1/h1-10H |
| InChIKey | WDRWISSDJPHLMN-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 77.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|