C8H16O5 — CID 143692870
ethane;2-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptane-4,5-diol (PubChem CID 143692870) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is ethane;2-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptane-4,5-diol.
| Compound Name | ethane;2-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptane-4,5-diol |
|---|---|
| PubChem CID | 143692870 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | ethane;2-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptane-4,5-diol |
| SMILES | CC.OCC1OC(O)C(O)C2OC12 |
| InChI | InChI=1S/C6H10O5.C2H6/c7-1-2-4-5(11-4)3(8)6(9)10-2;1-2/h2-9H,1H2;1-2H3 |
| InChIKey | GIZHFUIORZYMJV-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|