C5H8O4 — CID 141076482
(1R,2R,4R,5R)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-ol (PubChem CID 141076482) has the molecular formula C5H8O4 and a molecular weight of 132.11 g/mol. Its IUPAC name is (1R,2R,4R,5R)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-ol.
| Compound Name | (1R,2R,4R,5R)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-ol |
|---|---|
| PubChem CID | 141076482 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.11 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (1R,2R,4R,5R)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-ol |
| SMILES | OC[C@H]1O[C@@H](O)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C5H8O4/c6-1-2-3-4(9-3)5(7)8-2/h2-7H,1H2/t2-,3-,4-,5-/m1/s1 |
| InChIKey | OKNJQMFVESGAOO-TXICZTDVSA-N |
| XLogP | -1.54 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.11 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|