C9H18O5Si — CID 88596824
(1R,2S,4R,5R,6R)-4-(hydroxymethyl)-5-trimethylsilyloxy-3,7-dioxabicyclo[4.1.0]heptan-2-ol (PubChem CID 88596824) has the molecular formula C9H18O5Si and a molecular weight of 234.32 g/mol. Its IUPAC name is (1R,2S,4R,5R,6R)-4-(hydroxymethyl)-5-trimethylsilyloxy-3,7-dioxabicyclo[4.1.0]heptan-2-ol.
| Compound Name | (1R,2S,4R,5R,6R)-4-(hydroxymethyl)-5-trimethylsilyloxy-3,7-dioxabicyclo[4.1.0]heptan-2-ol |
|---|---|
| PubChem CID | 88596824 |
| Molecular Formula | C9H18O5Si |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (1R,2S,4R,5R,6R)-4-(hydroxymethyl)-5-trimethylsilyloxy-3,7-dioxabicyclo[4.1.0]heptan-2-ol |
| SMILES | C[Si](C)(C)O[C@H]1[C@@H]2O[C@H]2[C@@H](O)O[C@@H]1CO |
| InChI | InChI=1S/C9H18O5Si/c1-15(2,3)14-6-5(4-10)12-9(11)8-7(6)13-8/h5-11H,4H2,1-3H3/t5-,6-,7+,8-,9+/m1/s1 |
| InChIKey | HZATWKOSULIZBW-ZEBDFXRSSA-N |
| XLogP | -0.32 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|