C13H31NO5Si2 — CID 165180262
[(2R,3S,4R,5R,6R)-5-amino-6-methoxy-3,4-bis(trimethylsilyloxy)oxan-2-yl]methanol (PubChem CID 165180262) has the molecular formula C13H31NO5Si2 and a molecular weight of 337.57 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-amino-6-methoxy-3,4-bis(trimethylsilyloxy)oxan-2-yl]methanol.
| Compound Name | [(2R,3S,4R,5R,6R)-5-amino-6-methoxy-3,4-bis(trimethylsilyloxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 165180262 |
| Molecular Formula | C13H31NO5Si2 |
| Molecular Weight | 337.57 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-amino-6-methoxy-3,4-bis(trimethylsilyloxy)oxan-2-yl]methanol |
| SMILES | CO[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N |
| InChI | InChI=1S/C13H31NO5Si2/c1-16-13-10(14)12(19-21(5,6)7)11(9(8-15)17-13)18-20(2,3)4/h9-13,15H,8,14H2,1-7H3/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | VCFOBSLWZYHDLQ-UJPOAAIJSA-N |
| XLogP | 1.12 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.57 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|