C9H19NO3 — CID 59893568
[(3R,6R)-5-amino-6-methoxy-3,4-dimethyloxan-2-yl]methanol (PubChem CID 59893568) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is [(3R,6R)-5-amino-6-methoxy-3,4-dimethyloxan-2-yl]methanol.
| Compound Name | [(3R,6R)-5-amino-6-methoxy-3,4-dimethyloxan-2-yl]methanol |
|---|---|
| PubChem CID | 59893568 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | [(3R,6R)-5-amino-6-methoxy-3,4-dimethyloxan-2-yl]methanol |
| SMILES | CO[C@@H]1OC(CO)[C@H](C)C(C)C1N |
| InChI | InChI=1S/C9H19NO3/c1-5-6(2)8(10)9(12-3)13-7(5)4-11/h5-9,11H,4,10H2,1-3H3/t5-,6?,7?,8?,9-/m1/s1 |
| InChIKey | DLOVDFVIOMBROL-NHMDFMCYSA-N |
| XLogP | -0.05 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |