C12H19NO7 — CID 90864816
(3S,4S,6R)-5-amino-2-(hydroxymethyl)-6-methoxy-3-methyloxan-4-ol;furan-2,5-dione (PubChem CID 90864816) has the molecular formula C12H19NO7 and a molecular weight of 289.28 g/mol. Its IUPAC name is (3S,4S,6R)-5-amino-2-(hydroxymethyl)-6-methoxy-3-methyloxan-4-ol;furan-2,5-dione.
| Compound Name | (3S,4S,6R)-5-amino-2-(hydroxymethyl)-6-methoxy-3-methyloxan-4-ol;furan-2,5-dione |
|---|---|
| PubChem CID | 90864816 |
| Molecular Formula | C12H19NO7 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (3S,4S,6R)-5-amino-2-(hydroxymethyl)-6-methoxy-3-methyloxan-4-ol;furan-2,5-dione |
| SMILES | CO[C@@H]1OC(CO)[C@@H](C)[C@H](O)C1N.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C8H17NO4.C4H2O3/c1-4-5(3-10)13-8(12-2)6(9)7(4)11;5-3-1-2-4(6)7-3/h4-8,10-11H,3,9H2,1-2H3;1-2H/t4-,5?,6?,7+,8-;/m1./s1 |
| InChIKey | LZJVQGLWFUXJOG-YWHPRTAFSA-N |
| XLogP | -1.70 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|