C10H21NO5 — CID 58807594
(3R,4S,6R)-5-amino-2-(2-hydroxyethoxymethyl)-6-methoxy-3-methyloxan-4-ol (PubChem CID 58807594) has the molecular formula C10H21NO5 and a molecular weight of 235.28 g/mol. Its IUPAC name is (3R,4S,6R)-5-amino-2-(2-hydroxyethoxymethyl)-6-methoxy-3-methyloxan-4-ol.
| Compound Name | (3R,4S,6R)-5-amino-2-(2-hydroxyethoxymethyl)-6-methoxy-3-methyloxan-4-ol |
|---|---|
| PubChem CID | 58807594 |
| Molecular Formula | C10H21NO5 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (3R,4S,6R)-5-amino-2-(2-hydroxyethoxymethyl)-6-methoxy-3-methyloxan-4-ol |
| SMILES | CO[C@@H]1OC(COCCO)[C@H](C)[C@H](O)C1N |
| InChI | InChI=1S/C10H21NO5/c1-6-7(5-15-4-3-12)16-10(14-2)8(11)9(6)13/h6-10,12-13H,3-5,11H2,1-2H3/t6-,7?,8?,9-,10+/m0/s1 |
| InChIKey | UGBRXCORAXXRQA-SOHWVZJWSA-N |
| XLogP | -1.31 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|