C15H30O10 — CID 19991269
2-[[3,4,5-tris(2-hydroxyethoxy)-6-methoxyoxan-2-yl]methoxy]ethanol (PubChem CID 19991269) has the molecular formula C15H30O10 and a molecular weight of 370.40 g/mol. Its IUPAC name is 2-[[3,4,5-tris(2-hydroxyethoxy)-6-methoxyoxan-2-yl]methoxy]ethanol.
| Compound Name | 2-[[3,4,5-tris(2-hydroxyethoxy)-6-methoxyoxan-2-yl]methoxy]ethanol |
|---|---|
| PubChem CID | 19991269 |
| Molecular Formula | C15H30O10 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-[[3,4,5-tris(2-hydroxyethoxy)-6-methoxyoxan-2-yl]methoxy]ethanol |
| SMILES | COC1OC(COCCO)C(OCCO)C(OCCO)C1OCCO |
| InChI | InChI=1S/C15H30O10/c1-20-15-14(24-9-5-19)13(23-8-4-18)12(22-7-3-17)11(25-15)10-21-6-2-16/h11-19H,2-10H2,1H3 |
| InChIKey | UITSPQLTFPTHJZ-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|