C12H24O7 — CID 130303988
5-(2-hydroxyethoxy)-2-(2-hydroxyethoxymethyl)-6-methoxy-3-methyloxan-4-ol (PubChem CID 130303988) has the molecular formula C12H24O7 and a molecular weight of 280.32 g/mol. Its IUPAC name is 5-(2-hydroxyethoxy)-2-(2-hydroxyethoxymethyl)-6-methoxy-3-methyloxan-4-ol.
| Compound Name | 5-(2-hydroxyethoxy)-2-(2-hydroxyethoxymethyl)-6-methoxy-3-methyloxan-4-ol |
|---|---|
| PubChem CID | 130303988 |
| Molecular Formula | C12H24O7 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 5-(2-hydroxyethoxy)-2-(2-hydroxyethoxymethyl)-6-methoxy-3-methyloxan-4-ol |
| SMILES | COC1OC(COCCO)C(C)C(O)C1OCCO |
| InChI | InChI=1S/C12H24O7/c1-8-9(7-17-5-3-13)19-12(16-2)11(10(8)15)18-6-4-14/h8-15H,3-7H2,1-2H3 |
| InChIKey | BYBOAMGQDGZARL-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|