C13H24O9 — CID 167060038
(2S,3S,4R,5R)-2-[[(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-methoxy-3-methyloxan-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 167060038) has the molecular formula C13H24O9 and a molecular weight of 324.33 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[[(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-methoxy-3-methyloxan-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R)-2-[[(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-methoxy-3-methyloxan-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 167060038 |
| Molecular Formula | C13H24O9 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (2S,3S,4R,5R)-2-[[(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-methoxy-3-methyloxan-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | CO[C@H]1O[C@@H](CO[C@@H]2OC[C@@H](O)[C@@H](O)[C@@H]2O)[C@H](C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H24O9/c1-5-7(22-12(19-2)10(17)8(5)15)4-21-13-11(18)9(16)6(14)3-20-13/h5-18H,3-4H2,1-2H3/t5-,6+,7-,8+,9+,10+,11-,12-,13-/m0/s1 |
| InChIKey | FRVZBNVCFDDGPM-NWFSRDJTSA-N |
| XLogP | -2.83 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |