C17H30O15 — CID 91847673
(2R,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol (PubChem CID 91847673) has the molecular formula C17H30O15 and a molecular weight of 474.41 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 91847673 |
| Molecular Formula | C17H30O15 |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](O)O[C@H](CO[C@@H]2O[C@H](CO[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@H]1O |
| InChI | InChI=1S/C17H30O15/c18-4-1-28-16(13(25)7(4)19)29-3-6-9(21)11(23)14(26)17(32-6)30-2-5-8(20)10(22)12(24)15(27)31-5/h4-27H,1-3H2/t4-,5-,6-,7+,8-,9-,10+,11+,12-,13-,14-,15-,16+,17-/m1/s1 |
| InChIKey | LHIYHFBXEMYOAG-QLLATXPDSA-N |
| XLogP | -6.93 |
| TPSA | 248.45 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | -6.93 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |