C16H28O14 — CID 91847426
(2R,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol (PubChem CID 91847426) has the molecular formula C16H28O14 and a molecular weight of 444.39 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 91847426 |
| Molecular Formula | C16H28O14 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](O)O[C@H](CO[C@@H]2OC[C@H](O[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H]1O |
| InChI | InChI=1S/C16H28O14/c17-4-1-26-16(12(23)7(4)18)30-6-3-28-15(13(24)9(6)20)27-2-5-8(19)10(21)11(22)14(25)29-5/h4-25H,1-3H2/t4-,5-,6+,7+,8-,9+,10+,11-,12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | DPUCGNOWTNSAQQ-VADBSHKBSA-N |
| XLogP | -6.29 |
| TPSA | 228.22 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | -6.29 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |