C11H20O10 — CID 52940241
(2R,3R,4S,5S,6R)-6-[[(4S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol (PubChem CID 52940241) has the molecular formula C11H20O10 and a molecular weight of 312.27 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-[[(4S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-6-[[(4S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 52940241 |
| Molecular Formula | C11H20O10 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-[[(4S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
| SMILES | OC1COC(OC[C@H]2O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)C(O)[C@H]1O |
| InChI | InChI=1S/C11H20O10/c12-3-1-19-11(9(17)5(3)13)20-2-4-6(14)7(15)8(16)10(18)21-4/h3-18H,1-2H2/t3?,4-,5+,6-,7+,8-,9?,10-,11?/m1/s1 |
| InChIKey | QYNRIDLOTGRNML-AXDFMPPISA-N |
| XLogP | -4.76 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | -4.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |