C13H24O10 — CID 90479210
(2R,3R,4S,5S,6R)-2-ethoxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol (PubChem CID 90479210) has the molecular formula C13H24O10 and a molecular weight of 340.33 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-ethoxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-ethoxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90479210 |
| Molecular Formula | C13H24O10 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-ethoxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol |
| SMILES | CCO[C@@H]1O[C@H](CO[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H24O10/c1-2-20-13-11(19)9(17)8(16)6(23-13)4-22-12-10(18)7(15)5(14)3-21-12/h5-19H,2-4H2,1H3/t5-,6-,7+,8-,9+,10-,11-,12+,13-/m1/s1 |
| InChIKey | BGSGYDHAVKDHQK-OCFMYHKXSA-N |
| XLogP | -3.71 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |