C19H36O10 — CID 162910983
(2R,3R,4S,5S,6R)-2-[(3R)-3-ethyl-4-methylpentoxy]-6-[[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol (PubChem CID 162910983) has the molecular formula C19H36O10 and a molecular weight of 424.49 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(3R)-3-ethyl-4-methylpentoxy]-6-[[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(3R)-3-ethyl-4-methylpentoxy]-6-[[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162910983 |
| Molecular Formula | C19H36O10 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(3R)-3-ethyl-4-methylpentoxy]-6-[[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol |
| SMILES | CC[C@H](CCO[C@@H]1O[C@H](CO[C@H]2OC[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O)C(C)C |
| InChI | InChI=1S/C19H36O10/c1-4-10(9(2)3)5-6-26-19-17(25)15(23)14(22)12(29-19)8-28-18-16(24)13(21)11(20)7-27-18/h9-25H,4-8H2,1-3H3/t10-,11+,12-,13+,14-,15+,16-,17-,18-,19-/m1/s1 |
| InChIKey | QJQOVJJFDMZWSM-IYEWIBSDSA-N |
| XLogP | -1.66 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |