C18H32O12 — CID 102372367
butyl (2R)-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxypropanoate (PubChem CID 102372367) has the molecular formula C18H32O12 and a molecular weight of 440.44 g/mol. Its IUPAC name is butyl (2R)-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxypropanoate.
| Compound Name | butyl (2R)-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 102372367 |
| Molecular Formula | C18H32O12 |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | butyl (2R)-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxypropanoate |
| SMILES | CCCCOC(=O)[C@@H](C)O[C@@H]1O[C@H](CO[C@@H]2OC[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H32O12/c1-3-4-5-26-16(25)8(2)29-18-15(24)13(22)12(21)10(30-18)7-28-17-14(23)11(20)9(19)6-27-17/h8-15,17-24H,3-7H2,1-2H3/t8-,9+,10-,11+,12-,13+,14-,15-,17+,18-/m1/s1 |
| InChIKey | INVNLYNDLJREQZ-FCKSIVATSA-N |
| XLogP | -3.00 |
| TPSA | 184.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|